C10H17N3 — CID 143794573
6-ethyl-1,3-dimethyl-4,5-dihydro-2H-benzotriazole (PubChem CID 143794573) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 6-ethyl-1,3-dimethyl-4,5-dihydro-2H-benzotriazole.
| Compound Name | 6-ethyl-1,3-dimethyl-4,5-dihydro-2H-benzotriazole |
|---|---|
| PubChem CID | 143794573 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 6-ethyl-1,3-dimethyl-4,5-dihydro-2H-benzotriazole |
| SMILES | CCC1=CC2=C(CC1)N(C)NN2C |
| InChI | InChI=1S/C10H17N3/c1-4-8-5-6-9-10(7-8)13(3)11-12(9)2/h7,11H,4-6H2,1-3H3 |
| InChIKey | KEXSLOQCYFAUCF-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |