C20H23ClN2O — CID 143798780
2-(5-chloro-3-ethyl-2-propylindol-1-yl)-1-pyridin-3-ylethanol (PubChem CID 143798780) has the molecular formula C20H23ClN2O and a molecular weight of 342.87 g/mol. Its IUPAC name is 2-(5-chloro-3-ethyl-2-propylindol-1-yl)-1-pyridin-3-ylethanol.
| Compound Name | 2-(5-chloro-3-ethyl-2-propylindol-1-yl)-1-pyridin-3-ylethanol |
|---|---|
| PubChem CID | 143798780 |
| Molecular Formula | C20H23ClN2O |
| Molecular Weight | 342.87 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 2-(5-chloro-3-ethyl-2-propylindol-1-yl)-1-pyridin-3-ylethanol |
| SMILES | CCCc1c(CC)c2cc(Cl)ccc2n1CC(O)c1cccnc1 |
| InChI | InChI=1S/C20H23ClN2O/c1-3-6-18-16(4-2)17-11-15(21)8-9-19(17)23(18)13-20(24)14-7-5-10-22-12-14/h5,7-12,20,24H,3-4,6,13H2,1-2H3 |
| InChIKey | WDNHMCNSJJSFOU-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.87 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|