C28H31N6PS — CID 143799129
2-N-[4-[4-[amino(phenyl)methyl]piperidin-1-yl]sulfanylphenyl]-4-N-(4-phosphanylphenyl)pyrimidine-2,4-diamine (PubChem CID 143799129) has the molecular formula C28H31N6PS and a molecular weight of 514.64 g/mol. Its IUPAC name is 2-N-[4-[4-[amino(phenyl)methyl]piperidin-1-yl]sulfanylphenyl]-4-N-(4-phosphanylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 2-N-[4-[4-[amino(phenyl)methyl]piperidin-1-yl]sulfanylphenyl]-4-N-(4-phosphanylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 143799129 |
| Molecular Formula | C28H31N6PS |
| Molecular Weight | 514.64 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | 2-N-[4-[4-[amino(phenyl)methyl]piperidin-1-yl]sulfanylphenyl]-4-N-(4-phosphanylphenyl)pyrimidine-2,4-diamine |
| SMILES | NC(c1ccccc1)C1CCN(Sc2ccc(Nc3nccc(Nc4ccc(P)cc4)n3)cc2)CC1 |
| InChI | InChI=1S/C28H31N6PS/c29-27(20-4-2-1-3-5-20)21-15-18-34(19-16-21)36-25-12-8-23(9-13-25)32-28-30-17-14-26(33-28)31-22-6-10-24(35)11-7-22/h1-14,17,21,27H,15-16,18-19,29,35H2,(H2,30,31,32,33) |
| InChIKey | DNUPYFUZEAUADQ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.64 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|