C12H21NO — CID 143800436
(2R)-2-cyclohexa-1,5-dien-1-ylmorpholine;ethane (PubChem CID 143800436) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is (2R)-2-cyclohexa-1,5-dien-1-ylmorpholine;ethane.
| Compound Name | (2R)-2-cyclohexa-1,5-dien-1-ylmorpholine;ethane |
|---|---|
| PubChem CID | 143800436 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | (2R)-2-cyclohexa-1,5-dien-1-ylmorpholine;ethane |
| SMILES | C1=CC([C@@H]2CNCCO2)=CCC1.CC |
| InChI | InChI=1S/C10H15NO.C2H6/c1-2-4-9(5-3-1)10-8-11-6-7-12-10;1-2/h2,4-5,10-11H,1,3,6-8H2;1-2H3/t10-;/m0./s1 |
| InChIKey | UQJHQIZHOCCHCS-PPHPATTJSA-N |
| XLogP | 2.28 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |