C13H23NO — CID 143800485
(2R)-2-cyclohexa-1,5-dien-1-ylmorpholine;propane (PubChem CID 143800485) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is (2R)-2-cyclohexa-1,5-dien-1-ylmorpholine;propane.
| Compound Name | (2R)-2-cyclohexa-1,5-dien-1-ylmorpholine;propane |
|---|---|
| PubChem CID | 143800485 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | (2R)-2-cyclohexa-1,5-dien-1-ylmorpholine;propane |
| SMILES | C1=CC([C@@H]2CNCCO2)=CCC1.CCC |
| InChI | InChI=1S/C10H15NO.C3H8/c1-2-4-9(5-3-1)10-8-11-6-7-12-10;1-3-2/h2,4-5,10-11H,1,3,6-8H2;3H2,1-2H3/t10-;/m0./s1 |
| InChIKey | RGCRTEQCBDCCDE-PPHPATTJSA-N |
| XLogP | 2.67 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |