C11H20N2O — CID 143800491
(2R)-2-cyclohexa-1,5-dien-1-ylmorpholine;methanamine (PubChem CID 143800491) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is (2R)-2-cyclohexa-1,5-dien-1-ylmorpholine;methanamine.
| Compound Name | (2R)-2-cyclohexa-1,5-dien-1-ylmorpholine;methanamine |
|---|---|
| PubChem CID | 143800491 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | (2R)-2-cyclohexa-1,5-dien-1-ylmorpholine;methanamine |
| SMILES | C1=CC([C@@H]2CNCCO2)=CCC1.CN |
| InChI | InChI=1S/C10H15NO.CH5N/c1-2-4-9(5-3-1)10-8-11-6-7-12-10;1-2/h2,4-5,10-11H,1,3,6-8H2;2H2,1H3/t10-;/m0./s1 |
| InChIKey | GRMJMNTYSHYILL-PPHPATTJSA-N |
| XLogP | 0.83 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |