C9H17NO — CID 143800900
4,6-dimethyl-3,4-dihydro-1H-pyridin-2-one;ethane (PubChem CID 143800900) has the molecular formula C9H17NO and a molecular weight of 155.24 g/mol. Its IUPAC name is 4,6-dimethyl-3,4-dihydro-1H-pyridin-2-one;ethane.
| Compound Name | 4,6-dimethyl-3,4-dihydro-1H-pyridin-2-one;ethane |
|---|---|
| PubChem CID | 143800900 |
| Molecular Formula | C9H17NO |
| Molecular Weight | 155.24 g/mol |
| Exact Mass | 155.13 |
| IUPAC Name | 4,6-dimethyl-3,4-dihydro-1H-pyridin-2-one;ethane |
| SMILES | CC.CC1=CC(C)CC(=O)N1 |
| InChI | InChI=1S/C7H11NO.C2H6/c1-5-3-6(2)8-7(9)4-5;1-2/h3,5H,4H2,1-2H3,(H,8,9);1-2H3 |
| InChIKey | URGPNRZULDVMEL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.24 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |