C10H14O3 — CID 143805450
methyl (5E)-5-ethylidene-4-methyl-4H-pyran-3-carboxylate (PubChem CID 143805450) has the molecular formula C10H14O3 and a molecular weight of 182.22 g/mol. Its IUPAC name is methyl (5E)-5-ethylidene-4-methyl-4H-pyran-3-carboxylate.
| Compound Name | methyl (5E)-5-ethylidene-4-methyl-4H-pyran-3-carboxylate |
|---|---|
| PubChem CID | 143805450 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | methyl (5E)-5-ethylidene-4-methyl-4H-pyran-3-carboxylate |
| SMILES | C/C=C1/COC=C(C(=O)OC)C1C |
| InChI | InChI=1S/C10H14O3/c1-4-8-5-13-6-9(7(8)2)10(11)12-3/h4,6-7H,5H2,1-3H3/b8-4- |
| InChIKey | XRXJDGYLXSTTJR-YWEYNIOJSA-N |
| XLogP | 1.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|