C22H23N — CID 143806230
(1E,4Z)-N-methyl-7-(4-methylphenyl)-1-phenylocta-1,4,7-trien-3-imine (PubChem CID 143806230) has the molecular formula C22H23N and a molecular weight of 301.43 g/mol. Its IUPAC name is (1E,4Z)-N-methyl-7-(4-methylphenyl)-1-phenylocta-1,4,7-trien-3-imine.
| Compound Name | (1E,4Z)-N-methyl-7-(4-methylphenyl)-1-phenylocta-1,4,7-trien-3-imine |
|---|---|
| PubChem CID | 143806230 |
| Molecular Formula | C22H23N |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | (1E,4Z)-N-methyl-7-(4-methylphenyl)-1-phenylocta-1,4,7-trien-3-imine |
| SMILES | C=C(C/C=C\C(\C=C\c1ccccc1)=N\C)c1ccc(C)cc1 |
| InChI | InChI=1S/C22H23N/c1-18-12-15-21(16-13-18)19(2)8-7-11-22(23-3)17-14-20-9-5-4-6-10-20/h4-7,9-17H,2,8H2,1,3H3/b11-7-,17-14+,23-22- |
| InChIKey | AIAJBXSLMFKMTK-JRRKNYGASA-N |
| XLogP | 5.74 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|