C16H16N+ — CID 177386853
4-methyl-1-[(3E)-4-phenylbuta-1,3-dien-2-yl]pyridin-1-ium (PubChem CID 177386853) has the molecular formula C16H16N+ and a molecular weight of 222.31 g/mol. Its IUPAC name is 4-methyl-1-[(3E)-4-phenylbuta-1,3-dien-2-yl]pyridin-1-ium.
| Compound Name | 4-methyl-1-[(3E)-4-phenylbuta-1,3-dien-2-yl]pyridin-1-ium |
|---|---|
| PubChem CID | 177386853 |
| Molecular Formula | C16H16N+ |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | 4-methyl-1-[(3E)-4-phenylbuta-1,3-dien-2-yl]pyridin-1-ium |
| SMILES | C=C(/C=C/c1ccccc1)[n+]1ccc(C)cc1 |
| InChI | InChI=1S/C16H16N/c1-14-10-12-17(13-11-14)15(2)8-9-16-6-4-3-5-7-16/h3-13H,2H2,1H3/q+1/b9-8+ |
| InChIKey | LAQFEFFFMCROLC-CMDGGOBGSA-N |
| XLogP | 3.47 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|