C23H25NO2 — CID 142918101
(1E,4Z)-N-methyl-1-phenylhexa-1,4-dien-3-imine;5-prop-1-en-2-yl-1,3-benzodioxole (PubChem CID 142918101) has the molecular formula C23H25NO2 and a molecular weight of 347.46 g/mol. Its IUPAC name is (1E,4Z)-N-methyl-1-phenylhexa-1,4-dien-3-imine;5-prop-1-en-2-yl-1,3-benzodioxole.
| Compound Name | (1E,4Z)-N-methyl-1-phenylhexa-1,4-dien-3-imine;5-prop-1-en-2-yl-1,3-benzodioxole |
|---|---|
| PubChem CID | 142918101 |
| Molecular Formula | C23H25NO2 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | (1E,4Z)-N-methyl-1-phenylhexa-1,4-dien-3-imine;5-prop-1-en-2-yl-1,3-benzodioxole |
| SMILES | C/C=C\C(\C=C\c1ccccc1)=N/C.C=C(C)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H15N.C10H10O2/c1-3-7-13(14-2)11-10-12-8-5-4-6-9-12;1-7(2)8-3-4-9-10(5-8)12-6-11-9/h3-11H,1-2H3;3-5H,1,6H2,2H3/b7-3-,11-10+,14-13+; |
| InChIKey | QGKCUMCILURYMX-GTXXMZSTSA-N |
| XLogP | 5.80 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|