C23H29NO3S — CID 142918098
1-(1,3-benzodioxol-5-yl)ethanone;ethane;(1E,4Z)-N-methyl-1-thiophen-2-ylhepta-1,4-dien-3-imine (PubChem CID 142918098) has the molecular formula C23H29NO3S and a molecular weight of 399.56 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)ethanone;ethane;(1E,4Z)-N-methyl-1-thiophen-2-ylhepta-1,4-dien-3-imine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)ethanone;ethane;(1E,4Z)-N-methyl-1-thiophen-2-ylhepta-1,4-dien-3-imine |
|---|---|
| PubChem CID | 142918098 |
| Molecular Formula | C23H29NO3S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)ethanone;ethane;(1E,4Z)-N-methyl-1-thiophen-2-ylhepta-1,4-dien-3-imine |
| SMILES | CC.CC(=O)c1ccc2c(c1)OCO2.CC/C=C\C(\C=C\c1cccs1)=N/C |
| InChI | InChI=1S/C12H15NS.C9H8O3.C2H6/c1-3-4-6-11(13-2)8-9-12-7-5-10-14-12;1-6(10)7-2-3-8-9(4-7)12-5-11-8;1-2/h4-10H,3H2,1-2H3;2-4H,5H2,1H3;1-2H3/b6-4-,9-8+,13-11+;; |
| InChIKey | KRSMOKYEOVMVTK-JKHFGWBQSA-N |
| XLogP | 6.44 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|