C16H28BN3O2 — CID 143810157
2,3-dimethyl-3-[methyl-(2-piperazin-1-yl-4-pyridinyl)boranyl]oxybutan-2-ol (PubChem CID 143810157) has the molecular formula C16H28BN3O2 and a molecular weight of 305.23 g/mol. Its IUPAC name is 2,3-dimethyl-3-[methyl-(2-piperazin-1-yl-4-pyridinyl)boranyl]oxybutan-2-ol.
| Compound Name | 2,3-dimethyl-3-[methyl-(2-piperazin-1-yl-4-pyridinyl)boranyl]oxybutan-2-ol |
|---|---|
| PubChem CID | 143810157 |
| Molecular Formula | C16H28BN3O2 |
| Molecular Weight | 305.23 g/mol |
| Exact Mass | 305.23 |
| IUPAC Name | 2,3-dimethyl-3-[methyl-(2-piperazin-1-yl-4-pyridinyl)boranyl]oxybutan-2-ol |
| SMILES | CB(OC(C)(C)C(C)(C)O)c1ccnc(N2CCNCC2)c1 |
| InChI | InChI=1S/C16H28BN3O2/c1-15(2,21)16(3,4)22-17(5)13-6-7-19-14(12-13)20-10-8-18-9-11-20/h6-7,12,18,21H,8-11H2,1-5H3 |
| InChIKey | YSWUSMYYVIXIIT-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 57.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.23 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|