C24H27NO — CID 143811249
3-amino-2-[(3Z)-4-(2-methylphenyl)buta-1,3-dien-2-yl]inden-1-one;butane (PubChem CID 143811249) has the molecular formula C24H27NO and a molecular weight of 345.49 g/mol. Its IUPAC name is 3-amino-2-[(3Z)-4-(2-methylphenyl)buta-1,3-dien-2-yl]inden-1-one;butane.
| Compound Name | 3-amino-2-[(3Z)-4-(2-methylphenyl)buta-1,3-dien-2-yl]inden-1-one;butane |
|---|---|
| PubChem CID | 143811249 |
| Molecular Formula | C24H27NO |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 3-amino-2-[(3Z)-4-(2-methylphenyl)buta-1,3-dien-2-yl]inden-1-one;butane |
| SMILES | C=C(/C=C\c1ccccc1C)C1=C(N)c2ccccc2C1=O.CCCC |
| InChI | InChI=1S/C20H17NO.C4H10/c1-13-7-3-4-8-15(13)12-11-14(2)18-19(21)16-9-5-6-10-17(16)20(18)22;1-3-4-2/h3-12H,2,21H2,1H3;3-4H2,1-2H3/b12-11-; |
| InChIKey | HNQBXQCCYRVFJB-AFEZEDKISA-N |
| XLogP | 5.94 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|