C24H32N2O5 — CID 143815031
(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-N-[1-(4-nitrophenyl)ethenyl]-1-oxaspiro[2.5]octan-6-amine (PubChem CID 143815031) has the molecular formula C24H32N2O5 and a molecular weight of 428.53 g/mol. Its IUPAC name is (3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-N-[1-(4-nitrophenyl)ethenyl]-1-oxaspiro[2.5]octan-6-amine.
| Compound Name | (3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-N-[1-(4-nitrophenyl)ethenyl]-1-oxaspiro[2.5]octan-6-amine |
|---|---|
| PubChem CID | 143815031 |
| Molecular Formula | C24H32N2O5 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.23 |
| IUPAC Name | (3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-N-[1-(4-nitrophenyl)ethenyl]-1-oxaspiro[2.5]octan-6-amine |
| SMILES | C=C(N[C@@H]1CC[C@]2(CO2)[C@@H]([C@@]2(C)O[C@@H]2CC=C(C)C)[C@@H]1OC)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H32N2O5/c1-15(2)6-11-20-23(4,31-20)22-21(29-5)19(12-13-24(22)14-30-24)25-16(3)17-7-9-18(10-8-17)26(27)28/h6-10,19-22,25H,3,11-14H2,1-2,4-5H3/t19-,20-,21-,22-,23+,24+/m1/s1 |
| InChIKey | ADSADLZIROAOHF-SJUWYAIISA-N |
| XLogP | 4.23 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|