C16H27ClO4 — CID 162902741
(1R,2R,3S,4R)-1-(chloromethyl)-3-methoxy-2-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]cyclohexane-1,4-diol (PubChem CID 162902741) has the molecular formula C16H27ClO4 and a molecular weight of 318.84 g/mol. Its IUPAC name is (1R,2R,3S,4R)-1-(chloromethyl)-3-methoxy-2-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]cyclohexane-1,4-diol.
| Compound Name | (1R,2R,3S,4R)-1-(chloromethyl)-3-methoxy-2-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]cyclohexane-1,4-diol |
|---|---|
| PubChem CID | 162902741 |
| Molecular Formula | C16H27ClO4 |
| Molecular Weight | 318.84 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | (1R,2R,3S,4R)-1-(chloromethyl)-3-methoxy-2-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]cyclohexane-1,4-diol |
| SMILES | CO[C@@H]1[C@H](O)CC[C@](O)(CCl)[C@@H]1[C@@]1(C)O[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C16H27ClO4/c1-10(2)5-6-12-15(3,21-12)14-13(20-4)11(18)7-8-16(14,19)9-17/h5,11-14,18-19H,6-9H2,1-4H3/t11-,12-,13-,14+,15+,16+/m1/s1 |
| InChIKey | IKABKKYGJWCZMB-ODICJLLRSA-N |
| XLogP | 2.26 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.84 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|