C24H31ClO7 — CID 70674037
2-[(1R,2S,3S,4R)-4-(chloromethyl)-4-hydroxy-2-methoxy-3-[(2S,3S)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]cyclohexyl]oxycarbonylbenzoic acid (PubChem CID 70674037) has the molecular formula C24H31ClO7 and a molecular weight of 466.96 g/mol. Its IUPAC name is 2-[(1R,2S,3S,4R)-4-(chloromethyl)-4-hydroxy-2-methoxy-3-[(2S,3S)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]cyclohexyl]oxycarbonylbenzoic acid.
| Compound Name | 2-[(1R,2S,3S,4R)-4-(chloromethyl)-4-hydroxy-2-methoxy-3-[(2S,3S)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]cyclohexyl]oxycarbonylbenzoic acid |
|---|---|
| PubChem CID | 70674037 |
| Molecular Formula | C24H31ClO7 |
| Molecular Weight | 466.96 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 2-[(1R,2S,3S,4R)-4-(chloromethyl)-4-hydroxy-2-methoxy-3-[(2S,3S)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]cyclohexyl]oxycarbonylbenzoic acid |
| SMILES | CO[C@@H]1[C@H](OC(=O)c2ccccc2C(=O)O)CC[C@](O)(CCl)[C@H]1[C@]1(C)O[C@H]1CC=C(C)C |
| InChI | InChI=1S/C24H31ClO7/c1-14(2)9-10-18-23(3,32-18)20-19(30-4)17(11-12-24(20,29)13-25)31-22(28)16-8-6-5-7-15(16)21(26)27/h5-9,17-20,29H,10-13H2,1-4H3,(H,26,27)/t17-,18+,19-,20-,23-,24+/m1/s1 |
| InChIKey | AMSMVHAZBRREGD-HYVWOMBXSA-N |
| XLogP | 3.82 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.96 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|