C25H34ClNO7S — CID 19800988
[4-(benzenesulfinylmethyl)-4-hydroxy-2-methoxy-3-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]cyclohexyl] N-(2-chloroacetyl)carbamate (PubChem CID 19800988) has the molecular formula C25H34ClNO7S and a molecular weight of 528.07 g/mol. Its IUPAC name is [4-(benzenesulfinylmethyl)-4-hydroxy-2-methoxy-3-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]cyclohexyl] N-(2-chloroacetyl)carbamate.
| Compound Name | [4-(benzenesulfinylmethyl)-4-hydroxy-2-methoxy-3-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]cyclohexyl] N-(2-chloroacetyl)carbamate |
|---|---|
| PubChem CID | 19800988 |
| Molecular Formula | C25H34ClNO7S |
| Molecular Weight | 528.07 g/mol |
| Exact Mass | 527.17 |
| IUPAC Name | [4-(benzenesulfinylmethyl)-4-hydroxy-2-methoxy-3-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]cyclohexyl] N-(2-chloroacetyl)carbamate |
| SMILES | COC1C(OC(=O)NC(=O)CCl)CCC(O)(CS(=O)c2ccccc2)C1C1(C)OC1CC=C(C)C |
| InChI | InChI=1S/C25H34ClNO7S/c1-16(2)10-11-19-24(3,34-19)22-21(32-4)18(33-23(29)27-20(28)14-26)12-13-25(22,30)15-35(31)17-8-6-5-7-9-17/h5-10,18-19,21-22,30H,11-15H2,1-4H3,(H,27,28,29) |
| InChIKey | AOEGBFLECFJAOV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.07 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|