C25H39ClNO6S+ — CID 19801038
[4-[(2-chloroacetyl)carbamoyloxy]-1-hydroxy-3-methoxy-2-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]cyclohexyl]methyl-bis(prop-2-enyl)sulfanium (PubChem CID 19801038) has the molecular formula C25H39ClNO6S+ and a molecular weight of 517.11 g/mol. Its IUPAC name is [4-[(2-chloroacetyl)carbamoyloxy]-1-hydroxy-3-methoxy-2-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]cyclohexyl]methyl-bis(prop-2-enyl)sulfanium.
| Compound Name | [4-[(2-chloroacetyl)carbamoyloxy]-1-hydroxy-3-methoxy-2-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]cyclohexyl]methyl-bis(prop-2-enyl)sulfanium |
|---|---|
| PubChem CID | 19801038 |
| Molecular Formula | C25H39ClNO6S+ |
| Molecular Weight | 517.11 g/mol |
| Exact Mass | 516.22 |
| IUPAC Name | [4-[(2-chloroacetyl)carbamoyloxy]-1-hydroxy-3-methoxy-2-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]cyclohexyl]methyl-bis(prop-2-enyl)sulfanium |
| SMILES | C=CC[S+](CC=C)CC1(O)CCC(OC(=O)NC(=O)CCl)C(OC)C1C1(C)OC1CC=C(C)C |
| InChI | InChI=1S/C25H38ClNO6S/c1-7-13-34(14-8-2)16-25(30)12-11-18(32-23(29)27-20(28)15-26)21(31-6)22(25)24(5)19(33-24)10-9-17(3)4/h7-9,18-19,21-22,30H,1-2,10-16H2,3-6H3/p+1 |
| InChIKey | ZFMILWFRDBTULY-UHFFFAOYSA-O |
| XLogP | 3.51 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.11 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|