C21H35ClINO6S — CID 10077164
[(1R,2S,3S,4R)-4-[(2-chloroacetyl)carbamoyloxy]-1-hydroxy-3-methoxy-2-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]cyclohexyl]methyl-dimethylsulfanium iodide (PubChem CID 10077164) has the molecular formula C21H35ClINO6S and a molecular weight of 591.94 g/mol. Its IUPAC name is [(1R,2S,3S,4R)-4-[(2-chloroacetyl)carbamoyloxy]-1-hydroxy-3-methoxy-2-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]cyclohexyl]methyl-dimethylsulfanium iodide.
| Compound Name | [(1R,2S,3S,4R)-4-[(2-chloroacetyl)carbamoyloxy]-1-hydroxy-3-methoxy-2-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]cyclohexyl]methyl-dimethylsulfanium iodide |
|---|---|
| PubChem CID | 10077164 |
| Molecular Formula | C21H35ClINO6S |
| Molecular Weight | 591.94 g/mol |
| Exact Mass | 591.09 |
| IUPAC Name | [(1R,2S,3S,4R)-4-[(2-chloroacetyl)carbamoyloxy]-1-hydroxy-3-methoxy-2-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]cyclohexyl]methyl-dimethylsulfanium iodide |
| SMILES | CO[C@@H]1[C@H](OC(=O)NC(=O)CCl)CC[C@](O)(C[S+](C)C)[C@H]1[C@@]1(C)O[C@@H]1CC=C(C)C.[I-] |
| InChI | InChI=1S/C21H34ClNO6S.HI/c1-13(2)7-8-15-20(3,29-15)18-17(27-4)14(28-19(25)23-16(24)11-22)9-10-21(18,26)12-30(5)6;/h7,14-15,17-18,26H,8-12H2,1-6H3;1H/t14-,15-,17-,18-,20+,21+;/m1./s1 |
| InChIKey | SNHVULAQPIDVGE-MYWIGKKBSA-N |
| XLogP | -0.60 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.94 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|