C22H37ClO8S — CID 19800980
[1,4-dihydroxy-3-methoxy-2-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]cyclohexyl]methyl-bis(prop-2-enyl)sulfanium perchlorate (PubChem CID 19800980) has the molecular formula C22H37ClO8S and a molecular weight of 497.05 g/mol. Its IUPAC name is [1,4-dihydroxy-3-methoxy-2-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]cyclohexyl]methyl-bis(prop-2-enyl)sulfanium perchlorate.
| Compound Name | [1,4-dihydroxy-3-methoxy-2-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]cyclohexyl]methyl-bis(prop-2-enyl)sulfanium perchlorate |
|---|---|
| PubChem CID | 19800980 |
| Molecular Formula | C22H37ClO8S |
| Molecular Weight | 497.05 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | [1,4-dihydroxy-3-methoxy-2-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]cyclohexyl]methyl-bis(prop-2-enyl)sulfanium perchlorate |
| SMILES | C=CC[S+](CC=C)CC1(O)CCC(O)C(OC)C1C1(C)OC1CC=C(C)C.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C22H37O4S.ClHO4/c1-7-13-27(14-8-2)15-22(24)12-11-17(23)19(25-6)20(22)21(5)18(26-21)10-9-16(3)4;2-1(3,4)5/h7-9,17-20,23-24H,1-2,10-15H2,3-6H3;(H,2,3,4,5)/q+1;/p-1 |
| InChIKey | PWAXCTVIHWITNT-UHFFFAOYSA-M |
| XLogP | -1.75 |
| TPSA | 154.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.05 |
| LogP ≤ 5 | -1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|