C17H30O4 — CID 123229081
2,4-dimethoxy-4-methyl-3-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]cyclohexan-1-ol (PubChem CID 123229081) has the molecular formula C17H30O4 and a molecular weight of 298.42 g/mol. Its IUPAC name is 2,4-dimethoxy-4-methyl-3-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]cyclohexan-1-ol.
| Compound Name | 2,4-dimethoxy-4-methyl-3-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 123229081 |
| Molecular Formula | C17H30O4 |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | 2,4-dimethoxy-4-methyl-3-[2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]cyclohexan-1-ol |
| SMILES | COC1C(O)CCC(C)(OC)C1C1(C)OC1CC=C(C)C |
| InChI | InChI=1S/C17H30O4/c1-11(2)7-8-13-17(4,21-13)15-14(19-5)12(18)9-10-16(15,3)20-6/h7,12-15,18H,8-10H2,1-6H3 |
| InChIKey | CGKOBNSURMRTTK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|