C16H28O2 — CID 142224165
2-(2-methoxy-2-methylcyclohexyl)-2-methyl-3-(3-methylbut-2-enyl)oxirane (PubChem CID 142224165) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is 2-(2-methoxy-2-methylcyclohexyl)-2-methyl-3-(3-methylbut-2-enyl)oxirane.
| Compound Name | 2-(2-methoxy-2-methylcyclohexyl)-2-methyl-3-(3-methylbut-2-enyl)oxirane |
|---|---|
| PubChem CID | 142224165 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 2-(2-methoxy-2-methylcyclohexyl)-2-methyl-3-(3-methylbut-2-enyl)oxirane |
| SMILES | COC1(C)CCCCC1C1(C)OC1CC=C(C)C |
| InChI | InChI=1S/C16H28O2/c1-12(2)9-10-14-16(4,18-14)13-8-6-7-11-15(13,3)17-5/h9,13-14H,6-8,10-11H2,1-5H3 |
| InChIKey | VKVNSFOEQHKUKU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|