C16H28O3S — CID 11973082
(1R,2S,4R)-2-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-(methylsulfanylmethyl)cyclohexane-1,4-diol (PubChem CID 11973082) has the molecular formula C16H28O3S and a molecular weight of 300.46 g/mol. Its IUPAC name is (1R,2S,4R)-2-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-(methylsulfanylmethyl)cyclohexane-1,4-diol.
| Compound Name | (1R,2S,4R)-2-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-(methylsulfanylmethyl)cyclohexane-1,4-diol |
|---|---|
| PubChem CID | 11973082 |
| Molecular Formula | C16H28O3S |
| Molecular Weight | 300.46 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | (1R,2S,4R)-2-[(2S,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-(methylsulfanylmethyl)cyclohexane-1,4-diol |
| SMILES | CSC[C@@]1(O)CC[C@@H](O)C[C@@H]1[C@]1(C)O[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C16H28O3S/c1-11(2)5-6-14-15(3,19-14)13-9-12(17)7-8-16(13,18)10-20-4/h5,12-14,17-18H,6-10H2,1-4H3/t12-,13-,14-,15+,16+/m1/s1 |
| InChIKey | QVNHPKWUAZQWPF-SUJAAXHWSA-N |
| XLogP | 2.76 |
| TPSA | 52.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|