C17H30O4S — CID 10065247
(1R,2S,3S,4R)-3-methoxy-2-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-(methylsulfanylmethyl)cyclohexane-1,4-diol (PubChem CID 10065247) has the molecular formula C17H30O4S and a molecular weight of 330.49 g/mol. Its IUPAC name is (1R,2S,3S,4R)-3-methoxy-2-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-(methylsulfanylmethyl)cyclohexane-1,4-diol.
| Compound Name | (1R,2S,3S,4R)-3-methoxy-2-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-(methylsulfanylmethyl)cyclohexane-1,4-diol |
|---|---|
| PubChem CID | 10065247 |
| Molecular Formula | C17H30O4S |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (1R,2S,3S,4R)-3-methoxy-2-[(2R,3R)-2-methyl-3-(3-methylbut-2-enyl)oxiran-2-yl]-1-(methylsulfanylmethyl)cyclohexane-1,4-diol |
| SMILES | CO[C@@H]1[C@H](O)CC[C@](O)(CSC)[C@H]1[C@@]1(C)O[C@@H]1CC=C(C)C |
| InChI | InChI=1S/C17H30O4S/c1-11(2)6-7-13-16(3,21-13)15-14(20-4)12(18)8-9-17(15,19)10-22-5/h6,12-15,18-19H,7-10H2,1-5H3/t12-,13-,14-,15-,16+,17+/m1/s1 |
| InChIKey | DPAFPXWXPDIQCX-KPLDXPABSA-N |
| XLogP | 2.38 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|