C19H32O4 — CID 134270888
(3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-[(E)-3-methylhept-2-enyl]oxiran-2-yl]-1-oxaspiro[2.5]octan-6-ol (PubChem CID 134270888) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is (3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-[(E)-3-methylhept-2-enyl]oxiran-2-yl]-1-oxaspiro[2.5]octan-6-ol.
| Compound Name | (3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-[(E)-3-methylhept-2-enyl]oxiran-2-yl]-1-oxaspiro[2.5]octan-6-ol |
|---|---|
| PubChem CID | 134270888 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | (3R,4S,5S,6R)-5-methoxy-4-[(2R,3R)-2-methyl-3-[(E)-3-methylhept-2-enyl]oxiran-2-yl]-1-oxaspiro[2.5]octan-6-ol |
| SMILES | CCCC/C(C)=C/C[C@H]1O[C@]1(C)[C@H]1[C@H](OC)[C@H](O)CC[C@]12CO2 |
| InChI | InChI=1S/C19H32O4/c1-5-6-7-13(2)8-9-15-18(3,23-15)17-16(21-4)14(20)10-11-19(17)12-22-19/h8,14-17,20H,5-7,9-12H2,1-4H3/b13-8+/t14-,15-,16-,17-,18+,19+/m1/s1 |
| InChIKey | LVPWPKAPUANEEV-YDXCMJMQSA-N |
| XLogP | 3.23 |
| TPSA | 54.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|