C31H46N2O — CID 143815956
2-[C-methyl-N-(2-methylphenyl)carbonimidoyl]-4-[4-[3-methyloct-1-en-2-yl(propyl)amino]butyl]phenol (PubChem CID 143815956) has the molecular formula C31H46N2O and a molecular weight of 462.72 g/mol. Its IUPAC name is 2-[C-methyl-N-(2-methylphenyl)carbonimidoyl]-4-[4-[3-methyloct-1-en-2-yl(propyl)amino]butyl]phenol.
| Compound Name | 2-[C-methyl-N-(2-methylphenyl)carbonimidoyl]-4-[4-[3-methyloct-1-en-2-yl(propyl)amino]butyl]phenol |
|---|---|
| PubChem CID | 143815956 |
| Molecular Formula | C31H46N2O |
| Molecular Weight | 462.72 g/mol |
| Exact Mass | 462.36 |
| IUPAC Name | 2-[C-methyl-N-(2-methylphenyl)carbonimidoyl]-4-[4-[3-methyloct-1-en-2-yl(propyl)amino]butyl]phenol |
| SMILES | C=C(C(C)CCCCC)N(CCC)CCCCc1ccc(O)c(/C(C)=N/c2ccccc2C)c1 |
| InChI | InChI=1S/C31H46N2O/c1-7-9-10-15-24(3)27(6)33(21-8-2)22-14-13-17-28-19-20-31(34)29(23-28)26(5)32-30-18-12-11-16-25(30)4/h11-12,16,18-20,23-24,34H,6-10,13-15,17,21-22H2,1-5H3/b32-26+ |
| InChIKey | XRNPCVJLYYYMGO-HMZBKAONSA-N |
| XLogP | 8.61 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.72 |
| LogP ≤ 5 | 8.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|