C22H29ClN2 — CID 143816280
N-butyl-4-chloro-3-[1-(2-methylanilino)ethenyl]-N-propylaniline (PubChem CID 143816280) has the molecular formula C22H29ClN2 and a molecular weight of 356.94 g/mol. Its IUPAC name is N-butyl-4-chloro-3-[1-(2-methylanilino)ethenyl]-N-propylaniline.
| Compound Name | N-butyl-4-chloro-3-[1-(2-methylanilino)ethenyl]-N-propylaniline |
|---|---|
| PubChem CID | 143816280 |
| Molecular Formula | C22H29ClN2 |
| Molecular Weight | 356.94 g/mol |
| Exact Mass | 356.20 |
| IUPAC Name | N-butyl-4-chloro-3-[1-(2-methylanilino)ethenyl]-N-propylaniline |
| SMILES | C=C(Nc1ccccc1C)c1cc(N(CCC)CCCC)ccc1Cl |
| InChI | InChI=1S/C22H29ClN2/c1-5-7-15-25(14-6-2)19-12-13-21(23)20(16-19)18(4)24-22-11-9-8-10-17(22)3/h8-13,16,24H,4-7,14-15H2,1-3H3 |
| InChIKey | RXEMTUAWVLICJI-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.94 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |