C31H51NO — CID 143816143
4-methylheptane;2-methylhexane;4-methyl-2-[1-(2-methylanilino)ethenyl]phenol (PubChem CID 143816143) has the molecular formula C31H51NO and a molecular weight of 453.76 g/mol. Its IUPAC name is 4-methylheptane;2-methylhexane;4-methyl-2-[1-(2-methylanilino)ethenyl]phenol.
| Compound Name | 4-methylheptane;2-methylhexane;4-methyl-2-[1-(2-methylanilino)ethenyl]phenol |
|---|---|
| PubChem CID | 143816143 |
| Molecular Formula | C31H51NO |
| Molecular Weight | 453.76 g/mol |
| Exact Mass | 453.40 |
| IUPAC Name | 4-methylheptane;2-methylhexane;4-methyl-2-[1-(2-methylanilino)ethenyl]phenol |
| SMILES | C=C(Nc1ccccc1C)c1cc(C)ccc1O.CCCC(C)CCC.CCCCC(C)C |
| InChI | InChI=1S/C16H17NO.C8H18.C7H16/c1-11-8-9-16(18)14(10-11)13(3)17-15-7-5-4-6-12(15)2;1-4-6-8(3)7-5-2;1-4-5-6-7(2)3/h4-10,17-18H,3H2,1-2H3;8H,4-7H2,1-3H3;7H,4-6H2,1-3H3 |
| InChIKey | PQCANPSSDWSKMX-UHFFFAOYSA-N |
| XLogP | 10.15 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.76 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |