C17H15F2N — CID 143818308
acetylene;2,7-difluorofluoren-9-imine;ethane (PubChem CID 143818308) has the molecular formula C17H15F2N and a molecular weight of 271.31 g/mol. Its IUPAC name is acetylene;2,7-difluorofluoren-9-imine;ethane.
| Compound Name | acetylene;2,7-difluorofluoren-9-imine;ethane |
|---|---|
| PubChem CID | 143818308 |
| Molecular Formula | C17H15F2N |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | acetylene;2,7-difluorofluoren-9-imine;ethane |
| SMILES | C#C.CC.[H]N=C1c2cc(F)ccc2-c2ccc(F)cc21 |
| InChI | InChI=1S/C13H7F2N.C2H6.C2H2/c14-7-1-3-9-10-4-2-8(15)6-12(10)13(16)11(9)5-7;2*1-2/h1-6,16H;1-2H3;1-2H |
| InChIKey | PYLGUAFZZSFMKA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|