C8H4F2 — CID 174821315
acetylene;2,3-difluorobicyclo[2.2.0]hexa-1,3,5-triene (PubChem CID 174821315) has the molecular formula C8H4F2 and a molecular weight of 138.12 g/mol. Its IUPAC name is acetylene;2,3-difluorobicyclo[2.2.0]hexa-1,3,5-triene.
| Compound Name | acetylene;2,3-difluorobicyclo[2.2.0]hexa-1,3,5-triene |
|---|---|
| PubChem CID | 174821315 |
| Molecular Formula | C8H4F2 |
| Molecular Weight | 138.12 g/mol |
| Exact Mass | 138.03 |
| IUPAC Name | acetylene;2,3-difluorobicyclo[2.2.0]hexa-1,3,5-triene |
| SMILES | C#C.Fc1c2ccc-2c1F |
| InChI | InChI=1S/C6H2F2.C2H2/c7-5-3-1-2-4(3)6(5)8;1-2/h1-2H;1-2H |
| InChIKey | ZUZJKIPEQALTFD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.12 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|