C14H22N2 — CID 143818348
ethane;2-[(2E,4Z)-4-ethenylhepta-2,4,6-trien-3-yl]-1,5-dihydropyrazole (PubChem CID 143818348) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is ethane;2-[(2E,4Z)-4-ethenylhepta-2,4,6-trien-3-yl]-1,5-dihydropyrazole.
| Compound Name | ethane;2-[(2E,4Z)-4-ethenylhepta-2,4,6-trien-3-yl]-1,5-dihydropyrazole |
|---|---|
| PubChem CID | 143818348 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | ethane;2-[(2E,4Z)-4-ethenylhepta-2,4,6-trien-3-yl]-1,5-dihydropyrazole |
| SMILES | C=C/C=C(C=C)\C(=C/C)N1C=CCN1.CC |
| InChI | InChI=1S/C12H16N2.C2H6/c1-4-8-11(5-2)12(6-3)14-10-7-9-13-14;1-2/h4-8,10,13H,1-2,9H2,3H3;1-2H3/b11-8-,12-6+; |
| InChIKey | CWHWXGBRKUNGKZ-UOBKYRCLSA-N |
| XLogP | 3.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|