C8H14N4 — CID 143819261
1,5-bis(ethenyl)-1,2,4-triazol-3-amine;ethane (PubChem CID 143819261) has the molecular formula C8H14N4 and a molecular weight of 166.23 g/mol. Its IUPAC name is 1,5-bis(ethenyl)-1,2,4-triazol-3-amine;ethane.
| Compound Name | 1,5-bis(ethenyl)-1,2,4-triazol-3-amine;ethane |
|---|---|
| PubChem CID | 143819261 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | 1,5-bis(ethenyl)-1,2,4-triazol-3-amine;ethane |
| SMILES | C=Cc1nc(N)nn1C=C.CC |
| InChI | InChI=1S/C6H8N4.C2H6/c1-3-5-8-6(7)9-10(5)4-2;1-2/h3-4H,1-2H2,(H2,7,9);1-2H3 |
| InChIKey | USEBGTPZXCIESQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |