C14H14F3NO2 — CID 143821213
ethyl 4-(2,4,5-trifluorophenyl)-1,2,3,6-tetrahydropyridine-5-carboxylate (PubChem CID 143821213) has the molecular formula C14H14F3NO2 and a molecular weight of 285.27 g/mol. Its IUPAC name is ethyl 4-(2,4,5-trifluorophenyl)-1,2,3,6-tetrahydropyridine-5-carboxylate.
| Compound Name | ethyl 4-(2,4,5-trifluorophenyl)-1,2,3,6-tetrahydropyridine-5-carboxylate |
|---|---|
| PubChem CID | 143821213 |
| Molecular Formula | C14H14F3NO2 |
| Molecular Weight | 285.27 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | ethyl 4-(2,4,5-trifluorophenyl)-1,2,3,6-tetrahydropyridine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(c2cc(F)c(F)cc2F)CCNC1 |
| InChI | InChI=1S/C14H14F3NO2/c1-2-20-14(19)10-7-18-4-3-8(10)9-5-12(16)13(17)6-11(9)15/h5-6,18H,2-4,7H2,1H3 |
| InChIKey | AAIZFPDLDGHPJV-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.27 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|