About ethyl 5-hydroxy-6-oxo-2,3-dihydro-1H-pyridine-4-carboxylate
ethyl 5-hydroxy-6-oxo-2,3-dihydro-1H-pyridine-4-carboxylate (PubChem CID 54692116) has the molecular formula C8H11NO4
and a molecular weight of 185.18 g/mol. Its IUPAC name is ethyl 5-hydroxy-6-oxo-2,3-dihydro-1H-pyridine-4-carboxylate.
Analyze ethyl 5-hydroxy-6-oxo-2,3-dihydro-1H-pyridine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-hydroxy-6-oxo-2,3-dihydro-1H-pyridine-4-carboxylate?
The IUPAC name of ethyl 5-hydroxy-6-oxo-2,3-dihydro-1H-pyridine-4-carboxylate (CID 54692116) is ethyl 5-hydroxy-6-oxo-2,3-dihydro-1H-pyridine-4-carboxylate.
What is the SMILES notation for ethyl 5-hydroxy-6-oxo-2,3-dihydro-1H-pyridine-4-carboxylate?
The canonical SMILES for ethyl 5-hydroxy-6-oxo-2,3-dihydro-1H-pyridine-4-carboxylate is CCOC(=O)C1=C(O)C(=O)NCC1.
What is the InChIKey of ethyl 5-hydroxy-6-oxo-2,3-dihydro-1H-pyridine-4-carboxylate?
The InChIKey is ZEAWXPIFCQTOLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO4/c1-2-13-8(12)5-3-4-9-7(11)6(5)10/h10H,2-4H2,1H3,(H,9,11).
What are the key properties of ethyl 5-hydroxy-6-oxo-2,3-dihydro-1H-pyridine-4-carboxylate?
ethyl 5-hydroxy-6-oxo-2,3-dihydro-1H-pyridine-4-carboxylate has a molecular weight of 185.18 g/mol, XLogP of -0.12, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-hydroxy-6-oxo-2,3-dihydro-1H-pyridine-4-carboxylate is sourced from PubChem (CID 54692116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).