About ethyl 2-oxo-6-propyl-3,4-dihydro-1H-pyridine-5-carboxylate
ethyl 2-oxo-6-propyl-3,4-dihydro-1H-pyridine-5-carboxylate (PubChem CID 71745342) has the molecular formula C11H17NO3
and a molecular weight of 211.26 g/mol. Its IUPAC name is ethyl 2-oxo-6-propyl-3,4-dihydro-1H-pyridine-5-carboxylate.
Analyze ethyl 2-oxo-6-propyl-3,4-dihydro-1H-pyridine-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-oxo-6-propyl-3,4-dihydro-1H-pyridine-5-carboxylate?
The IUPAC name of ethyl 2-oxo-6-propyl-3,4-dihydro-1H-pyridine-5-carboxylate (CID 71745342) is ethyl 2-oxo-6-propyl-3,4-dihydro-1H-pyridine-5-carboxylate.
What is the SMILES notation for ethyl 2-oxo-6-propyl-3,4-dihydro-1H-pyridine-5-carboxylate?
The canonical SMILES for ethyl 2-oxo-6-propyl-3,4-dihydro-1H-pyridine-5-carboxylate is CCCC1=C(C(=O)OCC)CCC(=O)N1.
What is the InChIKey of ethyl 2-oxo-6-propyl-3,4-dihydro-1H-pyridine-5-carboxylate?
The InChIKey is IAMVQUBWGWBCKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO3/c1-3-5-9-8(11(14)15-4-2)6-7-10(13)12-9/h3-7H2,1-2H3,(H,12,13).
What are the key properties of ethyl 2-oxo-6-propyl-3,4-dihydro-1H-pyridine-5-carboxylate?
ethyl 2-oxo-6-propyl-3,4-dihydro-1H-pyridine-5-carboxylate has a molecular weight of 211.26 g/mol, XLogP of 1.51, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-oxo-6-propyl-3,4-dihydro-1H-pyridine-5-carboxylate is sourced from PubChem (CID 71745342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).