C14H11F3O3 — CID 163922496
ethyl 5-methyl-2-(2,4,5-trifluorophenyl)furan-3-carboxylate (PubChem CID 163922496) has the molecular formula C14H11F3O3 and a molecular weight of 284.23 g/mol. Its IUPAC name is ethyl 5-methyl-2-(2,4,5-trifluorophenyl)furan-3-carboxylate.
| Compound Name | ethyl 5-methyl-2-(2,4,5-trifluorophenyl)furan-3-carboxylate |
|---|---|
| PubChem CID | 163922496 |
| Molecular Formula | C14H11F3O3 |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 284.07 |
| IUPAC Name | ethyl 5-methyl-2-(2,4,5-trifluorophenyl)furan-3-carboxylate |
| SMILES | CCOC(=O)c1cc(C)oc1-c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C14H11F3O3/c1-3-19-14(18)9-4-7(2)20-13(9)8-5-11(16)12(17)6-10(8)15/h4-6H,3H2,1-2H3 |
| InChIKey | RBPTVKDRPUHRGS-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|