C23H38N2O3 — CID 143822855
tert-butyl N-[3-[1-(4-tert-butylphenyl)ethyl-(2-oxopropyl)amino]propyl]carbamate (PubChem CID 143822855) has the molecular formula C23H38N2O3 and a molecular weight of 390.57 g/mol. Its IUPAC name is tert-butyl N-[3-[1-(4-tert-butylphenyl)ethyl-(2-oxopropyl)amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[1-(4-tert-butylphenyl)ethyl-(2-oxopropyl)amino]propyl]carbamate |
|---|---|
| PubChem CID | 143822855 |
| Molecular Formula | C23H38N2O3 |
| Molecular Weight | 390.57 g/mol |
| Exact Mass | 390.29 |
| IUPAC Name | tert-butyl N-[3-[1-(4-tert-butylphenyl)ethyl-(2-oxopropyl)amino]propyl]carbamate |
| SMILES | CC(=O)CN(CCCNC(=O)OC(C)(C)C)C(C)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H38N2O3/c1-17(26)16-25(15-9-14-24-21(27)28-23(6,7)8)18(2)19-10-12-20(13-11-19)22(3,4)5/h10-13,18H,9,14-16H2,1-8H3,(H,24,27) |
| InChIKey | JMFCISZDXDWFAC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.57 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|