C28H36ClF4NO2 — CID 143823843
N-(5-chloro-2-methylphenyl)but-3-en-2-imine;3-methylhexane;1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]ethanone (PubChem CID 143823843) has the molecular formula C28H36ClF4NO2 and a molecular weight of 530.05 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)but-3-en-2-imine;3-methylhexane;1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]ethanone.
| Compound Name | N-(5-chloro-2-methylphenyl)but-3-en-2-imine;3-methylhexane;1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]ethanone |
|---|---|
| PubChem CID | 143823843 |
| Molecular Formula | C28H36ClF4NO2 |
| Molecular Weight | 530.05 g/mol |
| Exact Mass | 529.24 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)but-3-en-2-imine;3-methylhexane;1-[2-(1,1,2,2-tetrafluoroethoxy)phenyl]ethanone |
| SMILES | C=C/C(C)=N/c1cc(Cl)ccc1C.CC(=O)c1ccccc1OC(F)(F)C(F)F.CCCC(C)CC |
| InChI | InChI=1S/C11H12ClN.C10H8F4O2.C7H16/c1-4-9(3)13-11-7-10(12)6-5-8(11)2;1-6(15)7-4-2-3-5-8(7)16-10(13,14)9(11)12;1-4-6-7(3)5-2/h4-7H,1H2,2-3H3;2-5,9H,1H3;7H,4-6H2,1-3H3/b13-9+;; |
| InChIKey | QLLJLIRFSUBTSQ-IGUOPLJTSA-N |
| XLogP | 9.89 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.05 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|