C46H39N5 — CID 143825122
N-[4-(8H-cyclohepta[b]indol-5-yl)phenyl]-N-cyclohexa-1,5-dien-1-yl-4-[4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-5-phenyl-1,2,4-triazol-3-yl]aniline (PubChem CID 143825122) has the molecular formula C46H39N5 and a molecular weight of 661.85 g/mol. Its IUPAC name is N-[4-(8H-cyclohepta[b]indol-5-yl)phenyl]-N-cyclohexa-1,5-dien-1-yl-4-[4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-5-phenyl-1,2,4-triazol-3-yl]aniline.
| Compound Name | N-[4-(8H-cyclohepta[b]indol-5-yl)phenyl]-N-cyclohexa-1,5-dien-1-yl-4-[4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-5-phenyl-1,2,4-triazol-3-yl]aniline |
|---|---|
| PubChem CID | 143825122 |
| Molecular Formula | C46H39N5 |
| Molecular Weight | 661.85 g/mol |
| Exact Mass | 661.32 |
| IUPAC Name | N-[4-(8H-cyclohepta[b]indol-5-yl)phenyl]-N-cyclohexa-1,5-dien-1-yl-4-[4-[(3Z,5Z)-hepta-1,3,5-trien-2-yl]-5-phenyl-1,2,4-triazol-3-yl]aniline |
| SMILES | C=C(/C=C\C=C/C)n1c(-c2ccccc2)nnc1-c1ccc(N(C2=CCCC=C2)c2ccc(-n3c4c(c5ccccc53)C=CCC=C4)cc2)cc1 |
| InChI | InChI=1S/C46H39N5/c1-3-4-8-17-34(2)49-45(35-18-9-5-10-19-35)47-48-46(49)36-26-28-38(29-27-36)50(37-20-11-6-12-21-37)39-30-32-40(33-31-39)51-43-24-14-7-13-22-41(43)42-23-15-16-25-44(42)51/h3-5,8-11,13-33H,2,6-7,12H2,1H3/b4-3-,17-8- |
| InChIKey | GKRANGORWFJEEG-LFSDHGSESA-N |
| XLogP | 11.96 |
| TPSA | 38.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.85 |
| LogP ≤ 5 | 11.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|