C9H14FN3O2 — CID 143827367
4-amino-5-fluoro-1-(1-propan-2-yloxyethyl)pyrimidin-2-one (PubChem CID 143827367) has the molecular formula C9H14FN3O2 and a molecular weight of 215.23 g/mol. Its IUPAC name is 4-amino-5-fluoro-1-(1-propan-2-yloxyethyl)pyrimidin-2-one.
| Compound Name | 4-amino-5-fluoro-1-(1-propan-2-yloxyethyl)pyrimidin-2-one |
|---|---|
| PubChem CID | 143827367 |
| Molecular Formula | C9H14FN3O2 |
| Molecular Weight | 215.23 g/mol |
| Exact Mass | 215.11 |
| IUPAC Name | 4-amino-5-fluoro-1-(1-propan-2-yloxyethyl)pyrimidin-2-one |
| SMILES | CC(C)OC(C)n1cc(F)c(N)nc1=O |
| InChI | InChI=1S/C9H14FN3O2/c1-5(2)15-6(3)13-4-7(10)8(11)12-9(13)14/h4-6H,1-3H3,(H2,11,12,14) |
| InChIKey | WUAZXCDZRVYXTB-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.23 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |