C13H21FN2 — CID 143831118
ethane;4-ethyl-5-fluoro-N',2-dimethylbenzenecarboximidamide (PubChem CID 143831118) has the molecular formula C13H21FN2 and a molecular weight of 224.32 g/mol. Its IUPAC name is ethane;4-ethyl-5-fluoro-N',2-dimethylbenzenecarboximidamide.
| Compound Name | ethane;4-ethyl-5-fluoro-N',2-dimethylbenzenecarboximidamide |
|---|---|
| PubChem CID | 143831118 |
| Molecular Formula | C13H21FN2 |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | ethane;4-ethyl-5-fluoro-N',2-dimethylbenzenecarboximidamide |
| SMILES | CC.CCc1cc(C)c(/C(N)=N/C)cc1F |
| InChI | InChI=1S/C11H15FN2.C2H6/c1-4-8-5-7(2)9(6-10(8)12)11(13)14-3;1-2/h5-6H,4H2,1-3H3,(H2,13,14);1-2H3 |
| InChIKey | QJUYNKSVSLYUCH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|