C25H32FNO2 — CID 143832748
ethyl 3-(4-fluorophenyl)-3-[2-[1-(4-methylphenyl)ethylamino]ethyl]hex-5-enoate (PubChem CID 143832748) has the molecular formula C25H32FNO2 and a molecular weight of 397.53 g/mol. Its IUPAC name is ethyl 3-(4-fluorophenyl)-3-[2-[1-(4-methylphenyl)ethylamino]ethyl]hex-5-enoate.
| Compound Name | ethyl 3-(4-fluorophenyl)-3-[2-[1-(4-methylphenyl)ethylamino]ethyl]hex-5-enoate |
|---|---|
| PubChem CID | 143832748 |
| Molecular Formula | C25H32FNO2 |
| Molecular Weight | 397.53 g/mol |
| Exact Mass | 397.24 |
| IUPAC Name | ethyl 3-(4-fluorophenyl)-3-[2-[1-(4-methylphenyl)ethylamino]ethyl]hex-5-enoate |
| SMILES | C=CCC(CCNC(C)c1ccc(C)cc1)(CC(=O)OCC)c1ccc(F)cc1 |
| InChI | InChI=1S/C25H32FNO2/c1-5-15-25(18-24(28)29-6-2,22-11-13-23(26)14-12-22)16-17-27-20(4)21-9-7-19(3)8-10-21/h5,7-14,20,27H,1,6,15-18H2,2-4H3 |
| InChIKey | BKGICJGIGYMBDK-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.53 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|