C26H35BFNO3 — CID 89131319
(3R)-3-(4-fluorophenyl)-1-[[(1S)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]amino]hex-5-en-3-ol (PubChem CID 89131319) has the molecular formula C26H35BFNO3 and a molecular weight of 439.38 g/mol. Its IUPAC name is (3R)-3-(4-fluorophenyl)-1-[[(1S)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]amino]hex-5-en-3-ol.
| Compound Name | (3R)-3-(4-fluorophenyl)-1-[[(1S)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]amino]hex-5-en-3-ol |
|---|---|
| PubChem CID | 89131319 |
| Molecular Formula | C26H35BFNO3 |
| Molecular Weight | 439.38 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | (3R)-3-(4-fluorophenyl)-1-[[(1S)-1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]amino]hex-5-en-3-ol |
| SMILES | C=CC[C@@](O)(CCN[C@@H](C)c1ccc(B2OC(C)(C)C(C)(C)O2)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H35BFNO3/c1-7-16-26(30,21-10-14-23(28)15-11-21)17-18-29-19(2)20-8-12-22(13-9-20)27-31-24(3,4)25(5,6)32-27/h7-15,19,29-30H,1,16-18H2,2-6H3/t19-,26+/m0/s1 |
| InChIKey | VMSYXNJLVMTCJJ-AFMDSPMNSA-N |
| XLogP | 4.63 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.38 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|