C24H32BrFN2OS — CID 68731785
N-[1-[[(1S)-1-(4-bromophenyl)ethyl]amino]-3-(4-fluorophenyl)hex-5-en-3-yl]-2-methylpropane-2-sulfinamide (PubChem CID 68731785) has the molecular formula C24H32BrFN2OS and a molecular weight of 495.50 g/mol. Its IUPAC name is N-[1-[[(1S)-1-(4-bromophenyl)ethyl]amino]-3-(4-fluorophenyl)hex-5-en-3-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[1-[[(1S)-1-(4-bromophenyl)ethyl]amino]-3-(4-fluorophenyl)hex-5-en-3-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 68731785 |
| Molecular Formula | C24H32BrFN2OS |
| Molecular Weight | 495.50 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | N-[1-[[(1S)-1-(4-bromophenyl)ethyl]amino]-3-(4-fluorophenyl)hex-5-en-3-yl]-2-methylpropane-2-sulfinamide |
| SMILES | C=CCC(CCN[C@@H](C)c1ccc(Br)cc1)(NS(=O)C(C)(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C24H32BrFN2OS/c1-6-15-24(28-30(29)23(3,4)5,20-9-13-22(26)14-10-20)16-17-27-18(2)19-7-11-21(25)12-8-19/h6-14,18,27-28H,1,15-17H2,2-5H3/t18-,24?,30?/m0/s1 |
| InChIKey | DEYZTGWGZZEQLY-CJDJHMNFSA-N |
| XLogP | 6.15 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.50 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|