C26H35BrN2O3S — CID 68551214
[(1S)-1-(4-bromophenyl)ethyl]-[4-(tert-butylsulfinylamino)-4-phenylhept-6-enyl]carbamic acid (PubChem CID 68551214) has the molecular formula C26H35BrN2O3S and a molecular weight of 535.55 g/mol. Its IUPAC name is [(1S)-1-(4-bromophenyl)ethyl]-[4-(tert-butylsulfinylamino)-4-phenylhept-6-enyl]carbamic acid.
| Compound Name | [(1S)-1-(4-bromophenyl)ethyl]-[4-(tert-butylsulfinylamino)-4-phenylhept-6-enyl]carbamic acid |
|---|---|
| PubChem CID | 68551214 |
| Molecular Formula | C26H35BrN2O3S |
| Molecular Weight | 535.55 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | [(1S)-1-(4-bromophenyl)ethyl]-[4-(tert-butylsulfinylamino)-4-phenylhept-6-enyl]carbamic acid |
| SMILES | C=CCC(CCCN(C(=O)O)[C@@H](C)c1ccc(Br)cc1)(NS(=O)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C26H35BrN2O3S/c1-6-17-26(22-11-8-7-9-12-22,28-33(32)25(3,4)5)18-10-19-29(24(30)31)20(2)21-13-15-23(27)16-14-21/h6-9,11-16,20,28H,1,10,17-19H2,2-5H3,(H,30,31)/t20-,26?,33?/m0/s1 |
| InChIKey | DEGZPDVNSMVHJB-OUVKIEMKSA-N |
| XLogP | 6.79 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.55 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|