C25H29F6NO2S — CID 131977543
N-[(2S)-1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phenylpent-4-en-2-yl]-2-methylpropane-2-sulfinamide (PubChem CID 131977543) has the molecular formula C25H29F6NO2S and a molecular weight of 521.57 g/mol. Its IUPAC name is N-[(2S)-1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phenylpent-4-en-2-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | N-[(2S)-1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phenylpent-4-en-2-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 131977543 |
| Molecular Formula | C25H29F6NO2S |
| Molecular Weight | 521.57 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | N-[(2S)-1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phenylpent-4-en-2-yl]-2-methylpropane-2-sulfinamide |
| SMILES | C=CC[C@](CO[C@H](C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)(NS(=O)C(C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C25H29F6NO2S/c1-6-12-23(19-10-8-7-9-11-19,32-35(33)22(3,4)5)16-34-17(2)18-13-20(24(26,27)28)15-21(14-18)25(29,30)31/h6-11,13-15,17,32H,1,12,16H2,2-5H3/t17-,23-,35?/m1/s1 |
| InChIKey | ZDMPDTCRMVYTKG-HOMIAYFLSA-N |
| XLogP | 7.33 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.57 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|