C33H33F6NO5 — CID 91494089
benzyl N-[(2S)-1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-5-(1,3-dioxan-2-yl)-2-phenylpent-3-en-2-yl]carbamate (PubChem CID 91494089) has the molecular formula C33H33F6NO5 and a molecular weight of 637.62 g/mol. Its IUPAC name is benzyl N-[(2S)-1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-5-(1,3-dioxan-2-yl)-2-phenylpent-3-en-2-yl]carbamate.
| Compound Name | benzyl N-[(2S)-1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-5-(1,3-dioxan-2-yl)-2-phenylpent-3-en-2-yl]carbamate |
|---|---|
| PubChem CID | 91494089 |
| Molecular Formula | C33H33F6NO5 |
| Molecular Weight | 637.62 g/mol |
| Exact Mass | 637.23 |
| IUPAC Name | benzyl N-[(2S)-1-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-5-(1,3-dioxan-2-yl)-2-phenylpent-3-en-2-yl]carbamate |
| SMILES | C[C@@H](OC[C@@](C=CCC1OCCCO1)(NC(=O)OCc1ccccc1)c1ccccc1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C33H33F6NO5/c1-23(25-18-27(32(34,35)36)20-28(19-25)33(37,38)39)45-22-31(26-12-6-3-7-13-26,15-8-14-29-42-16-9-17-43-29)40-30(41)44-21-24-10-4-2-5-11-24/h2-8,10-13,15,18-20,23,29H,9,14,16-17,21-22H2,1H3,(H,40,41)/t23-,31-/m1/s1 |
| InChIKey | CYYVRBKVYANNNW-SLGOVJDISA-N |
| XLogP | 8.33 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.62 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|