C35H35F6NO5 — CID 131977544
ethyl 2-[[[(2S)-1-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phenylpent-4-en-2-yl]-phenylmethoxycarbonylamino]methyl]prop-2-enoate (PubChem CID 131977544) has the molecular formula C35H35F6NO5 and a molecular weight of 663.66 g/mol. Its IUPAC name is ethyl 2-[[[(2S)-1-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phenylpent-4-en-2-yl]-phenylmethoxycarbonylamino]methyl]prop-2-enoate.
| Compound Name | ethyl 2-[[[(2S)-1-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phenylpent-4-en-2-yl]-phenylmethoxycarbonylamino]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 131977544 |
| Molecular Formula | C35H35F6NO5 |
| Molecular Weight | 663.66 g/mol |
| Exact Mass | 663.24 |
| IUPAC Name | ethyl 2-[[[(2S)-1-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-2-phenylpent-4-en-2-yl]-phenylmethoxycarbonylamino]methyl]prop-2-enoate |
| SMILES | C=CC[C@@](COC(C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)(c1ccccc1)N(CC(=C)C(=O)OCC)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C35H35F6NO5/c1-5-17-33(28-15-11-8-12-16-28,23-47-25(4)27-18-29(34(36,37)38)20-30(19-27)35(39,40)41)42(21-24(3)31(43)45-6-2)32(44)46-22-26-13-9-7-10-14-26/h5,7-16,18-20,25H,1,3,6,17,21-23H2,2,4H3/t25?,33-/m1/s1 |
| InChIKey | XHFHSVVEDPCYMX-SARHOQKNSA-N |
| XLogP | 9.03 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.66 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|