C21H27F6NO — CID 23574721
1-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-N,2-dimethyl-N-(2-methylprop-2-enyl)pent-4-en-2-amine (PubChem CID 23574721) has the molecular formula C21H27F6NO and a molecular weight of 423.44 g/mol. Its IUPAC name is 1-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-N,2-dimethyl-N-(2-methylprop-2-enyl)pent-4-en-2-amine.
| Compound Name | 1-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-N,2-dimethyl-N-(2-methylprop-2-enyl)pent-4-en-2-amine |
|---|---|
| PubChem CID | 23574721 |
| Molecular Formula | C21H27F6NO |
| Molecular Weight | 423.44 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 1-[1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-N,2-dimethyl-N-(2-methylprop-2-enyl)pent-4-en-2-amine |
| SMILES | C=CCC(C)(COC(C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1)N(C)CC(=C)C |
| InChI | InChI=1S/C21H27F6NO/c1-7-8-19(5,28(6)12-14(2)3)13-29-15(4)16-9-17(20(22,23)24)11-18(10-16)21(25,26)27/h7,9-11,15H,1-2,8,12-13H2,3-6H3 |
| InChIKey | WTPQTGYLTKIHNG-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.44 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|